C19H21N5O2 — CID 154880816
3-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazole (PubChem CID 154880816) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154880816 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-[4-[[1-(cyclopropylmethyl)aziridin-2-yl]methoxy]phenyl]-5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cn1cc(-c2nc(-c3ccc(OCC4CN4CC4CC4)cc3)no2)cn1 |
| InChI | InChI=1S/C19H21N5O2/c1-23-10-15(8-20-23)19-21-18(22-26-19)14-4-6-17(7-5-14)25-12-16-11-24(16)9-13-2-3-13/h4-8,10,13,16H,2-3,9,11-12H2,1H3 |
| InChIKey | WTWHFKGRTRVUGP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|