About N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide
N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide (PubChem CID 154881592) has the molecular formula C5H5BrN2OS
and a molecular weight of 221.08 g/mol. Its IUPAC name is N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide.
Molecular Properties
| Compound Name | N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide |
| PubChem CID | 154881592 |
| Molecular Formula | C5H5BrN2OS |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide |
| SMILES | Cc1sc(NC=O)nc1Br |
| InChI | InChI=1S/C5H5BrN2OS/c1-3-4(6)8-5(10-3)7-2-9/h2H,1H3,(H,7,8,9) |
| InChIKey | KAQWINLDLOLTKO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide?
The IUPAC name of N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide (CID 154881592) is N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide.
What is the SMILES notation for N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide?
The canonical SMILES for N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide is Cc1sc(NC=O)nc1Br.
What is the InChIKey of N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide?
The InChIKey is KAQWINLDLOLTKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2OS/c1-3-4(6)8-5(10-3)7-2-9/h2H,1H3,(H,7,8,9).
What are the key properties of N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide?
N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide has a molecular weight of 221.08 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-5-methyl-1,3-thiazol-2-yl)formamide is sourced from PubChem (CID 154881592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).