About 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide
3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide (PubChem CID 154882182) has the molecular formula C6H8F2N4O
and a molecular weight of 190.15 g/mol. Its IUPAC name is 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide |
| PubChem CID | 154882182 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide |
| SMILES | NC(=O)c1cc(N)nn1CC(F)F |
| InChI | InChI=1S/C6H8F2N4O/c7-4(8)2-12-3(6(10)13)1-5(9)11-12/h1,4H,2H2,(H2,9,11)(H2,10,13) |
| InChIKey | INPHKMNDOAYGLR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide?
The IUPAC name of 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide (CID 154882182) is 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide.
What is the SMILES notation for 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide?
The canonical SMILES for 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide is NC(=O)c1cc(N)nn1CC(F)F.
What is the InChIKey of 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide?
The InChIKey is INPHKMNDOAYGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4O/c7-4(8)2-12-3(6(10)13)1-5(9)11-12/h1,4H,2H2,(H2,9,11)(H2,10,13).
What are the key properties of 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide?
3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide has a molecular weight of 190.15 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2,2-difluoroethyl)pyrazole-5-carboxamide is sourced from PubChem (CID 154882182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).