About 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine
1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine (PubChem CID 154882484) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine |
| PubChem CID | 154882484 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine |
| SMILES | CCn1nc(C)c(N(C)C)c1C |
| InChI | InChI=1S/C9H17N3/c1-6-12-8(3)9(11(4)5)7(2)10-12/h6H2,1-5H3 |
| InChIKey | WOINGIRSKJFYGQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine?
The IUPAC name of 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine (CID 154882484) is 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine.
What is the SMILES notation for 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine?
The canonical SMILES for 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine is CCn1nc(C)c(N(C)C)c1C.
What is the InChIKey of 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine?
The InChIKey is WOINGIRSKJFYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-6-12-8(3)9(11(4)5)7(2)10-12/h6H2,1-5H3.
What are the key properties of 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine?
1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine has a molecular weight of 167.26 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N,3,5-tetramethylpyrazol-4-amine is sourced from PubChem (CID 154882484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).