About 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one
1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one (PubChem CID 154882591) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one |
| PubChem CID | 154882591 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one |
| SMILES | Cc1nc(C)c(C)c(N2CCN(Cc3ccn(C)c(=O)c3)CC2)n1 |
| InChI | InChI=1S/C18H25N5O/c1-13-14(2)19-15(3)20-18(13)23-9-7-22(8-10-23)12-16-5-6-21(4)17(24)11-16/h5-6,11H,7-10,12H2,1-4H3 |
| InChIKey | BVNUYTKNWUMPBA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one?
The IUPAC name of 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one (CID 154882591) is 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one.
What is the SMILES notation for 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one?
The canonical SMILES for 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one is Cc1nc(C)c(C)c(N2CCN(Cc3ccn(C)c(=O)c3)CC2)n1.
What is the InChIKey of 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one?
The InChIKey is BVNUYTKNWUMPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O/c1-13-14(2)19-15(3)20-18(13)23-9-7-22(8-10-23)12-16-5-6-21(4)17(24)11-16/h5-6,11H,7-10,12H2,1-4H3.
What are the key properties of 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one?
1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one has a molecular weight of 327.43 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]methyl]pyridin-2-one is sourced from PubChem (CID 154882591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).