C16H24Cl2N6O — CID 154885057
[2-amino-4-(cyclopropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone;dihydrochloride (PubChem CID 154885057) has the molecular formula C16H24Cl2N6O and a molecular weight of 387.32 g/mol. Its IUPAC name is [2-amino-4-(cyclopropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone;dihydrochloride.
| Compound Name | [2-amino-4-(cyclopropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 154885057 |
| Molecular Formula | C16H24Cl2N6O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [2-amino-4-(cyclopropylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(2,5-dihydro-1H-pyrrol-2-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc2c(c(NC3CC3)n1)CCN(C(=O)C1C=CCN1)CC2 |
| InChI | InChI=1S/C16H22N6O.2ClH/c17-16-20-12-6-9-22(15(23)13-2-1-7-18-13)8-5-11(12)14(21-16)19-10-3-4-10;;/h1-2,10,13,18H,3-9H2,(H3,17,19,20,21);2*1H |
| InChIKey | GRRXWJUVRFGPOI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|