C19H22F6N6O4 — CID 154885181
3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154885181) has the molecular formula C19H22F6N6O4 and a molecular weight of 512.41 g/mol. Its IUPAC name is 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154885181 |
| Molecular Formula | C19H22F6N6O4 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(N2CCN(Cc3n[nH]c4c3CCC4)CC2)nc1 |
| InChI | InChI=1S/C15H20N6.2C2HF3O2/c1-3-12-13(4-1)18-19-14(12)11-20-7-9-21(10-8-20)15-16-5-2-6-17-15;2*3-2(4,5)1(6)7/h2,5-6H,1,3-4,7-11H2,(H,18,19);2*(H,6,7) |
| InChIKey | NIRKNKOKUPHFQA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |