C17H24F3N3O3 — CID 154885313
N-[(1-methylimidazol-2-yl)methyl]-N-propan-2-ylcyclohex-3-ene-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154885313) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)methyl]-N-propan-2-ylcyclohex-3-ene-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1-methylimidazol-2-yl)methyl]-N-propan-2-ylcyclohex-3-ene-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154885313 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)methyl]-N-propan-2-ylcyclohex-3-ene-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N(Cc1nccn1C)C(=O)C1CC=CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O.C2HF3O2/c1-12(2)18(11-14-16-9-10-17(14)3)15(19)13-7-5-4-6-8-13;3-2(4,5)1(6)7/h4-5,9-10,12-13H,6-8,11H2,1-3H3;(H,6,7) |
| InChIKey | IHXLGGDXXIHFCX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|