C19H26ClN3O2 — CID 154886061
5-methyl-3-[[(1R,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methyl]-1H-indole-2-carboxylic acid;hydrochloride (PubChem CID 154886061) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 5-methyl-3-[[(1R,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methyl]-1H-indole-2-carboxylic acid;hydrochloride.
| Compound Name | 5-methyl-3-[[(1R,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methyl]-1H-indole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 154886061 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5-methyl-3-[[(1R,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]methyl]-1H-indole-2-carboxylic acid;hydrochloride |
| SMILES | Cc1ccc2[nH]c(C(=O)O)c(CN3CC[C@@H]4CC[C@H](C3)N4C)c2c1.Cl |
| InChI | InChI=1S/C19H25N3O2.ClH/c1-12-3-6-17-15(9-12)16(18(20-17)19(23)24)11-22-8-7-13-4-5-14(10-22)21(13)2;/h3,6,9,13-14,20H,4-5,7-8,10-11H2,1-2H3,(H,23,24);1H/t13-,14+;/m0./s1 |
| InChIKey | ZOTHVWAXXMGZFZ-LMRHVHIWSA-N |
| XLogP | 3.26 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|