C20H22F3N3O3S — CID 154886302
5-[(4,5-dimethylfuran-2-yl)methyl]-3-(thiophen-2-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 154886302) has the molecular formula C20H22F3N3O3S and a molecular weight of 441.48 g/mol. Its IUPAC name is 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(thiophen-2-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(thiophen-2-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154886302 |
| Molecular Formula | C20H22F3N3O3S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(thiophen-2-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(CN2CCc3[nH]nc(Cc4cccs4)c3C2)oc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3OS.C2HF3O2/c1-12-8-14(22-13(12)2)10-21-6-5-17-16(11-21)18(20-19-17)9-15-4-3-7-23-15;3-2(4,5)1(6)7/h3-4,7-8H,5-6,9-11H2,1-2H3,(H,19,20);(H,6,7) |
| InChIKey | ZLMUPTGCTRQHOD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |