C21H23F3N4O4 — CID 154886852
N-ethyl-2,3,6-trimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinoline-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154886852) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is N-ethyl-2,3,6-trimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinoline-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-ethyl-2,3,6-trimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154886852 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-ethyl-2,3,6-trimethyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(Cc1noc(C)n1)C(=O)c1c(C)c(C)nc2ccc(C)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N4O2.C2HF3O2/c1-6-23(10-17-21-14(5)25-22-17)19(24)18-12(3)13(4)20-16-8-7-11(2)9-15(16)18;3-2(4,5)1(6)7/h7-9H,6,10H2,1-5H3;(H,6,7) |
| InChIKey | ZDZJEMXPOGMCLX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |