C16H22F3N3O4 — CID 154887248
N-methyl-N-[(1-methylpiperidin-2-yl)methyl]-1-oxidopyridin-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154887248) has the molecular formula C16H22F3N3O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpiperidin-2-yl)methyl]-1-oxidopyridin-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-N-[(1-methylpiperidin-2-yl)methyl]-1-oxidopyridin-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887248 |
| Molecular Formula | C16H22F3N3O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-methyl-N-[(1-methylpiperidin-2-yl)methyl]-1-oxidopyridin-1-ium-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(CC1CCCCN1C)C(=O)c1ccc[n+]([O-])c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O2.C2HF3O2/c1-15-8-4-3-7-13(15)11-16(2)14(18)12-6-5-9-17(19)10-12;3-2(4,5)1(6)7/h5-6,9-10,13H,3-4,7-8,11H2,1-2H3;(H,6,7) |
| InChIKey | NMGQLONUXZHYHM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|