C20H19F3N4O3S — CID 154887329
5-(2-methylsulfanylphenyl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid (PubChem CID 154887329) has the molecular formula C20H19F3N4O3S and a molecular weight of 452.46 g/mol. Its IUPAC name is 5-(2-methylsulfanylphenyl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(2-methylsulfanylphenyl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887329 |
| Molecular Formula | C20H19F3N4O3S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 5-(2-methylsulfanylphenyl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
| SMILES | CSc1ccccc1-c1nc(-c2c(C)ncc3c2CCNC3)no1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18N4OS.C2HF3O2/c1-11-16(13-7-8-19-9-12(13)10-20-11)17-21-18(23-22-17)14-5-3-4-6-15(14)24-2;3-2(4,5)1(6)7/h3-6,10,19H,7-9H2,1-2H3;(H,6,7) |
| InChIKey | IDXWRXQFYMZWGF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |