C16H21ClN2O4 — CID 154887354
(3R)-N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;hydrochloride (PubChem CID 154887354) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is (3R)-N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;hydrochloride.
| Compound Name | (3R)-N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154887354 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3R)-N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H20N2O4.ClH/c19-13-8-22-14-12(7-21-15(13)14)18-16(20)11-5-9-3-1-2-4-10(9)6-17-11;/h1-4,11-15,17,19H,5-8H2,(H,18,20);1H/t11-,12-,13-,14-,15-;/m1./s1 |
| InChIKey | BDIRUAUEWFATMC-LGOICXCGSA-N |
| XLogP | -0.23 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |