C16H19F3N2O3S — CID 154887358
(1R,2R,4R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154887358) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is (1R,2R,4R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1R,2R,4R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887358 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (1R,2R,4R)-N-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CNC(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)sc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N2OS.C2HF3O2/c1-8-9(2)18-13(16-8)7-15-14(17)12-6-10-3-4-11(12)5-10;3-2(4,5)1(6)7/h3-4,10-12H,5-7H2,1-2H3,(H,15,17);(H,6,7)/t10-,11+,12-;/m1./s1 |
| InChIKey | QRJKIOVAJPGNGF-QMCLHUHBSA-N |
| XLogP | 3.22 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|