C25H27ClF6N2O5 — CID 154887408
(1R,2R)-1-[(3-chlorophenyl)methyl-methylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154887408) has the molecular formula C25H27ClF6N2O5 and a molecular weight of 584.94 g/mol. Its IUPAC name is (1R,2R)-1-[(3-chlorophenyl)methyl-methylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (1R,2R)-1-[(3-chlorophenyl)methyl-methylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154887408 |
| Molecular Formula | C25H27ClF6N2O5 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | (1R,2R)-1-[(3-chlorophenyl)methyl-methylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(Cc1cccc(Cl)c1)[C@@H]1c2ccccc2C2(CCNCC2)[C@H]1O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H25ClN2O.2C2HF3O2/c1-24(14-15-5-4-6-16(22)13-15)19-17-7-2-3-8-18(17)21(20(19)25)9-11-23-12-10-21;2*3-2(4,5)1(6)7/h2-8,13,19-20,23,25H,9-12,14H2,1H3;2*(H,6,7)/t19-,20+;;/m1../s1 |
| InChIKey | OQZMCOFOAIHQCZ-AAYDIPMQSA-N |
| XLogP | 4.78 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |