C15H18F3N5O3 — CID 154887447
2,5-dimethyl-N-[2-(pyridin-3-ylamino)ethyl]pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154887447) has the molecular formula C15H18F3N5O3 and a molecular weight of 373.34 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-(pyridin-3-ylamino)ethyl]pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2,5-dimethyl-N-[2-(pyridin-3-ylamino)ethyl]pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887447 |
| Molecular Formula | C15H18F3N5O3 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2,5-dimethyl-N-[2-(pyridin-3-ylamino)ethyl]pyrazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C(=O)NCCNc2cccnc2)n(C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H17N5O.C2HF3O2/c1-10-8-12(18(2)17-10)13(19)16-7-6-15-11-4-3-5-14-9-11;3-2(4,5)1(6)7/h3-5,8-9,15H,6-7H2,1-2H3,(H,16,19);(H,6,7) |
| InChIKey | JDRWYFPDEKYTEU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|