C19H20F3N3O4 — CID 154887707
[(2S)-4-methyl-2-phenylpiperazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 154887707) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is [(2S)-4-methyl-2-phenylpiperazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S)-4-methyl-2-phenylpiperazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887707 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [(2S)-4-methyl-2-phenylpiperazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(C(=O)c2cc[n+]([O-])cc2)[C@@H](c2ccccc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N3O2.C2HF3O2/c1-18-11-12-20(16(13-18)14-5-3-2-4-6-14)17(21)15-7-9-19(22)10-8-15;3-2(4,5)1(6)7/h2-10,16H,11-13H2,1H3;(H,6,7)/t16-;/m1./s1 |
| InChIKey | FSQJFMBEXBPMNQ-PKLMIRHRSA-N |
| XLogP | 2.08 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|