C25H31F6N3O5S — CID 154888066
(1R,2R)-1-(dimethylamino)-1'-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154888066) has the molecular formula C25H31F6N3O5S and a molecular weight of 599.59 g/mol. Its IUPAC name is (1R,2R)-1-(dimethylamino)-1'-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (1R,2R)-1-(dimethylamino)-1'-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154888066 |
| Molecular Formula | C25H31F6N3O5S |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | (1R,2R)-1-(dimethylamino)-1'-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(C)c(CN2CCC3(CC2)c2ccccc2[C@@H](N(C)C)[C@@H]3O)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H29N3OS.2C2HF3O2/c1-14-18(26-15(2)22-14)13-24-11-9-21(10-12-24)17-8-6-5-7-16(17)19(20(21)25)23(3)4;2*3-2(4,5)1(6)7/h5-8,19-20,25H,9-13H2,1-4H3;2*(H,6,7)/t19-,20+;;/m1../s1 |
| InChIKey | AKPHLQFAPMILGY-AAYDIPMQSA-N |
| XLogP | 4.54 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |