C14H21F3N4O3S — CID 154888488
2-(2-ethylsulfanylethyl)-5-piperazin-1-ylpyridazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 154888488) has the molecular formula C14H21F3N4O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-(2-ethylsulfanylethyl)-5-piperazin-1-ylpyridazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-ethylsulfanylethyl)-5-piperazin-1-ylpyridazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154888488 |
| Molecular Formula | C14H21F3N4O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(2-ethylsulfanylethyl)-5-piperazin-1-ylpyridazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CCSCCn1ncc(N2CCNCC2)cc1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H20N4OS.C2HF3O2/c1-2-18-8-7-16-12(17)9-11(10-14-16)15-5-3-13-4-6-15;3-2(4,5)1(6)7/h9-10,13H,2-8H2,1H3;(H,6,7) |
| InChIKey | BCMCWXPACYQBSY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|