C23H33F6N3O6S — CID 154888740
N-methyl-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-1,1-dioxothiolan-3-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154888740) has the molecular formula C23H33F6N3O6S and a molecular weight of 593.59 g/mol. Its IUPAC name is N-methyl-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-1,1-dioxothiolan-3-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-methyl-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-1,1-dioxothiolan-3-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154888740 |
| Molecular Formula | C23H33F6N3O6S |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | N-methyl-N-[3-[4-(4-methylphenyl)piperazin-1-yl]propyl]-1,1-dioxothiolan-3-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(N2CCN(CCCN(C)C3CCS(=O)(=O)C3)CC2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H31N3O2S.2C2HF3O2/c1-17-4-6-18(7-5-17)22-13-11-21(12-14-22)10-3-9-20(2)19-8-15-25(23,24)16-19;2*3-2(4,5)1(6)7/h4-7,19H,3,8-16H2,1-2H3;2*(H,6,7) |
| InChIKey | FNJYZOHPYOANDG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|