C20H21F3N4O3S — CID 154889708
3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(3-thiophen-2-ylpropyl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid (PubChem CID 154889708) has the molecular formula C20H21F3N4O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(3-thiophen-2-ylpropyl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(3-thiophen-2-ylpropyl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154889708 |
| Molecular Formula | C20H21F3N4O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-5-(3-thiophen-2-ylpropyl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncc2c(c1-c1noc(CCCc3cccs3)n1)CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N4OS.C2HF3O2/c1-12-17(15-7-8-19-10-13(15)11-20-12)18-21-16(23-22-18)6-2-4-14-5-3-9-24-14;3-2(4,5)1(6)7/h3,5,9,11,19H,2,4,6-8,10H2,1H3;(H,6,7) |
| InChIKey | BOTLNDSDFKLUQC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |