C16H20F3N5O3 — CID 154890585
1-[(2,5-dimethylphenyl)methyl]-3-(1,5-dimethyl-1,2,4-triazol-3-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 154890585) has the molecular formula C16H20F3N5O3 and a molecular weight of 387.36 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-(1,5-dimethyl-1,2,4-triazol-3-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-(1,5-dimethyl-1,2,4-triazol-3-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154890585 |
| Molecular Formula | C16H20F3N5O3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-(1,5-dimethyl-1,2,4-triazol-3-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C)c(CNC(=O)Nc2nc(C)n(C)n2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N5O.C2HF3O2/c1-9-5-6-10(2)12(7-9)8-15-14(20)17-13-16-11(3)19(4)18-13;3-2(4,5)1(6)7/h5-7H,8H2,1-4H3,(H2,15,17,18,20);(H,6,7) |
| InChIKey | RLKDLRHGRIXSOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |