C16H29Cl2N5O — CID 154890988
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(5-methyl-1H-imidazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride (PubChem CID 154890988) has the molecular formula C16H29Cl2N5O and a molecular weight of 378.35 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(5-methyl-1H-imidazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(5-methyl-1H-imidazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 154890988 |
| Molecular Formula | C16H29Cl2N5O |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-[(5-methyl-1H-imidazol-4-yl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one;dihydrochloride |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(Cc3nc[nH]c3C)CC[C@H]21.Cl.Cl |
| InChI | InChI=1S/C16H27N5O.2ClH/c1-12-14(19-11-18-12)10-20-7-5-15-13(9-20)3-4-16(22)21(15)8-6-17-2;;/h11,13,15,17H,3-10H2,1-2H3,(H,18,19);2*1H/t13-,15+;;/m0../s1 |
| InChIKey | BPYXVAJHUYLQPD-XITMACKWSA-N |
| XLogP | 1.59 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |