C11H14O4S — CID 15489179
(2S,3R,4S,5S)-2-phenylsulfanyloxane-3,4,5-triol (PubChem CID 15489179) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 15489179 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2S,3R,4S,5S)-2-phenylsulfanyloxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)OC[C@@H]1O |
| InChI | InChI=1S/C11H14O4S/c12-8-6-15-11(10(14)9(8)13)16-7-4-2-1-3-5-7/h1-5,8-14H,6H2/t8-,9-,10+,11-/m0/s1 |
| InChIKey | XLPYNUBZTOGBGH-MMWGEVLESA-N |
| XLogP | 0.22 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |