C24H21F3N4O3S — CID 154891883
5-(5-methyl-4-phenylthiophen-3-yl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid (PubChem CID 154891883) has the molecular formula C24H21F3N4O3S and a molecular weight of 502.52 g/mol. Its IUPAC name is 5-(5-methyl-4-phenylthiophen-3-yl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 5-(5-methyl-4-phenylthiophen-3-yl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154891883 |
| Molecular Formula | C24H21F3N4O3S |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 5-(5-methyl-4-phenylthiophen-3-yl)-3-(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-1,2,4-oxadiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncc2c(c1-c1noc(-c3csc(C)c3-c3ccccc3)n1)CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H20N4OS.C2HF3O2/c1-13-19(17-8-9-23-10-16(17)11-24-13)21-25-22(27-26-21)18-12-28-14(2)20(18)15-6-4-3-5-7-15;3-2(4,5)1(6)7/h3-7,11-12,23H,8-10H2,1-2H3;(H,6,7) |
| InChIKey | XZHWQFLNDNWNBY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |