C15H18F3N3O3 — CID 154892194
5-[(3,5-dimethylfuran-2-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 154892194) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 5-[(3,5-dimethylfuran-2-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(3,5-dimethylfuran-2-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154892194 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-[(3,5-dimethylfuran-2-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)c(CN2CCc3[nH]ncc3C2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H17N3O.C2HF3O2/c1-9-5-10(2)17-13(9)8-16-4-3-12-11(7-16)6-14-15-12;3-2(4,5)1(6)7/h5-6H,3-4,7-8H2,1-2H3,(H,14,15);(H,6,7) |
| InChIKey | OELVKHQFVGRSIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |