C18H26ClN3O4 — CID 154892305
3-[(3,5-dimethoxyphenyl)methyl]-5-methyl-5-piperidin-4-ylimidazolidine-2,4-dione;hydrochloride (PubChem CID 154892305) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methyl]-5-methyl-5-piperidin-4-ylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methyl]-5-methyl-5-piperidin-4-ylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 154892305 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methyl]-5-methyl-5-piperidin-4-ylimidazolidine-2,4-dione;hydrochloride |
| SMILES | COc1cc(CN2C(=O)NC(C)(C3CCNCC3)C2=O)cc(OC)c1.Cl |
| InChI | InChI=1S/C18H25N3O4.ClH/c1-18(13-4-6-19-7-5-13)16(22)21(17(23)20-18)11-12-8-14(24-2)10-15(9-12)25-3;/h8-10,13,19H,4-7,11H2,1-3H3,(H,20,23);1H |
| InChIKey | HHBPTPGHVFKOTE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|