C17H23Cl2F2N3O — CID 154893071
2-amino-1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone;dihydrochloride (PubChem CID 154893071) has the molecular formula C17H23Cl2F2N3O and a molecular weight of 394.29 g/mol. Its IUPAC name is 2-amino-1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone;dihydrochloride.
| Compound Name | 2-amino-1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 154893071 |
| Molecular Formula | C17H23Cl2F2N3O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-amino-1-[(2R,3S,6R)-3-(3,5-difluorophenyl)-1,5-diazatricyclo[5.2.2.02,6]undecan-5-yl]ethanone;dihydrochloride |
| SMILES | Cl.Cl.NCC(=O)N1C[C@H](c2cc(F)cc(F)c2)[C@@H]2[C@H]1C1CCN2CC1 |
| InChI | InChI=1S/C17H21F2N3O.2ClH/c18-12-5-11(6-13(19)7-12)14-9-22(15(23)8-20)16-10-1-3-21(4-2-10)17(14)16;;/h5-7,10,14,16-17H,1-4,8-9,20H2;2*1H/t14-,16-,17-;;/m1../s1 |
| InChIKey | ZKRFDNNQBPSXDZ-YZTBNWTJSA-N |
| XLogP | 2.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |