C18H20Cl2N4OS — CID 154893164
N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-1,3-benzothiazole-6-carboxamide;dihydrochloride (PubChem CID 154893164) has the molecular formula C18H20Cl2N4OS and a molecular weight of 411.36 g/mol. Its IUPAC name is N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-1,3-benzothiazole-6-carboxamide;dihydrochloride.
| Compound Name | N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-1,3-benzothiazole-6-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154893164 |
| Molecular Formula | C18H20Cl2N4OS |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[(3-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)methyl]-1,3-benzothiazole-6-carboxamide;dihydrochloride |
| SMILES | Cc1ncc2c(c1CNC(=O)c1ccc3ncsc3c1)CCNC2.Cl.Cl |
| InChI | InChI=1S/C18H18N4OS.2ClH/c1-11-15(14-4-5-19-7-13(14)8-20-11)9-21-18(23)12-2-3-16-17(6-12)24-10-22-16;;/h2-3,6,8,10,19H,4-5,7,9H2,1H3,(H,21,23);2*1H |
| InChIKey | FRLKPZMXGREQJK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |