About 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride
3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride (PubChem CID 154893179) has the molecular formula C13H19Cl3F2N2O
and a molecular weight of 363.66 g/mol. Its IUPAC name is 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride |
| PubChem CID | 154893179 |
| Molecular Formula | C13H19Cl3F2N2O |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(CNCc2c(F)ccc(Cl)c2F)CCCNC1 |
| InChI | InChI=1S/C13H17ClF2N2O.2ClH/c14-10-2-3-11(15)9(12(10)16)6-18-8-13(19)4-1-5-17-7-13;;/h2-3,17-19H,1,4-8H2;2*1H |
| InChIKey | COPKVCODHNKSPD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride?
The IUPAC name of 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride (CID 154893179) is 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride.
What is the SMILES notation for 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride?
The canonical SMILES for 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride is Cl.Cl.OC1(CNCc2c(F)ccc(Cl)c2F)CCCNC1.
What is the InChIKey of 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride?
The InChIKey is COPKVCODHNKSPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClF2N2O.2ClH/c14-10-2-3-11(15)9(12(10)16)6-18-8-13(19)4-1-5-17-7-13;;/h2-3,17-19H,1,4-8H2;2*1H.
What are the key properties of 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride?
3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride has a molecular weight of 363.66 g/mol, XLogP of 2.67, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3-chloro-2,6-difluorophenyl)methylamino]methyl]piperidin-3-ol;dihydrochloride is sourced from PubChem (CID 154893179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).