About 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride
3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride (PubChem CID 154893874) has the molecular formula C12H24Cl2N4OS
and a molecular weight of 343.32 g/mol. Its IUPAC name is 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride |
| PubChem CID | 154893874 |
| Molecular Formula | C12H24Cl2N4OS |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(CCCNCC2(O)CCCNC2)cs1 |
| InChI | InChI=1S/C12H22N4OS.2ClH/c13-11-16-10(7-18-11)3-1-5-14-8-12(17)4-2-6-15-9-12;;/h7,14-15,17H,1-6,8-9H2,(H2,13,16);2*1H |
| InChIKey | WUILVSWEURBEMP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride?
The IUPAC name of 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride (CID 154893874) is 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride.
What is the SMILES notation for 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride?
The canonical SMILES for 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride is Cl.Cl.Nc1nc(CCCNCC2(O)CCCNC2)cs1.
What is the InChIKey of 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride?
The InChIKey is WUILVSWEURBEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4OS.2ClH/c13-11-16-10(7-18-11)3-1-5-14-8-12(17)4-2-6-15-9-12;;/h7,14-15,17H,1-6,8-9H2,(H2,13,16);2*1H.
What are the key properties of 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride?
3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride has a molecular weight of 343.32 g/mol, XLogP of 1.21, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(2-amino-1,3-thiazol-4-yl)propylamino]methyl]piperidin-3-ol;dihydrochloride is sourced from PubChem (CID 154893874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).