C15H23Cl2N5 — CID 154894543
7-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3,5-trimethylpyrazolo[1,5-a]pyrimidine;dihydrochloride (PubChem CID 154894543) has the molecular formula C15H23Cl2N5 and a molecular weight of 344.29 g/mol. Its IUPAC name is 7-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3,5-trimethylpyrazolo[1,5-a]pyrimidine;dihydrochloride.
| Compound Name | 7-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3,5-trimethylpyrazolo[1,5-a]pyrimidine;dihydrochloride |
|---|---|
| PubChem CID | 154894543 |
| Molecular Formula | C15H23Cl2N5 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 7-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3,5-trimethylpyrazolo[1,5-a]pyrimidine;dihydrochloride |
| SMILES | Cc1cc(N2C[C@H]3CNC[C@H]3C2)n2nc(C)c(C)c2n1.Cl.Cl |
| InChI | InChI=1S/C15H21N5.2ClH/c1-9-4-14(19-7-12-5-16-6-13(12)8-19)20-15(17-9)10(2)11(3)18-20;;/h4,12-13,16H,5-8H2,1-3H3;2*1H/t12-,13+;; |
| InChIKey | ZVEJCNLXXCUEOE-FQDOXHKTSA-N |
| XLogP | 2.15 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |