C16H21ClN6S — CID 154894603
N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride (PubChem CID 154894603) has the molecular formula C16H21ClN6S and a molecular weight of 364.91 g/mol. Its IUPAC name is N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride.
| Compound Name | N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 154894603 |
| Molecular Formula | C16H21ClN6S |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(1-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-2-methyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;hydrochloride |
| SMILES | Cc1nc2c(c(NC(C)c3cn4ccsc4n3)n1)CCNCC2.Cl |
| InChI | InChI=1S/C16H20N6S.ClH/c1-10(14-9-22-7-8-23-16(22)21-14)18-15-12-3-5-17-6-4-13(12)19-11(2)20-15;/h7-10,17H,3-6H2,1-2H3,(H,18,19,20);1H |
| InChIKey | CJMTVBRPRIURTC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |