C16H27Cl2N5O — CID 154894854
N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride (PubChem CID 154894854) has the molecular formula C16H27Cl2N5O and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride.
| Compound Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154894854 |
| Molecular Formula | C16H27Cl2N5O |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1nc2c(c(N[C@H]3COC[C@@H]3N3CCCC3)n1)CCNCC2 |
| InChI | InChI=1S/C16H25N5O.2ClH/c1-2-8-21(7-1)15-10-22-9-14(15)20-16-12-3-5-17-6-4-13(12)18-11-19-16;;/h11,14-15,17H,1-10H2,(H,18,19,20);2*1H/t14-,15-;;/m0../s1 |
| InChIKey | ZFLPPJVBQDITKI-WVFPUEBHSA-N |
| XLogP | 1.28 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |