C17H28O — CID 15489561
(4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene (PubChem CID 15489561) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene.
| Compound Name | (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene |
|---|---|
| PubChem CID | 15489561 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (4aR,6aS,10aS,10bR)-4a,7,7,10a-tetramethyl-1,5,6,6a,8,9,10,10b-octahydrobenzo[f]chromene |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC=CO[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C17H28O/c1-15(2)9-6-10-16(3)13(15)8-11-17(4)14(16)7-5-12-18-17/h5,12-14H,6-11H2,1-4H3/t13-,14+,16-,17+/m0/s1 |
| InChIKey | PTSWQZGZSZFGQN-HDEZJCGLSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |