C19H28ClN3O2 — CID 154896608
1-[2-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]ethyl]pyrrolidin-2-one;hydrochloride (PubChem CID 154896608) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 1-[2-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]ethyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[2-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]ethyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 154896608 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[2-[1-[(2R)-2-amino-2-phenylacetyl]piperidin-4-yl]ethyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.N[C@@H](C(=O)N1CCC(CCN2CCCC2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O2.ClH/c20-18(16-5-2-1-3-6-16)19(24)22-13-9-15(10-14-22)8-12-21-11-4-7-17(21)23;/h1-3,5-6,15,18H,4,7-14,20H2;1H/t18-;/m1./s1 |
| InChIKey | XWAIPLLGGWBXGK-GMUIIQOCSA-N |
| XLogP | 2.36 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |