C19H23ClN4O2S — CID 154896936
N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)-3-(5-thiophen-2-ylfuran-2-yl)propanamide;hydrochloride (PubChem CID 154896936) has the molecular formula C19H23ClN4O2S and a molecular weight of 406.94 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)-3-(5-thiophen-2-ylfuran-2-yl)propanamide;hydrochloride.
| Compound Name | N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)-3-(5-thiophen-2-ylfuran-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 154896936 |
| Molecular Formula | C19H23ClN4O2S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-(5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepin-2-ylmethyl)-3-(5-thiophen-2-ylfuran-2-yl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCc1ccc(-c2cccs2)o1)NCc1cc2n(n1)CCCNC2 |
| InChI | InChI=1S/C19H22N4O2S.ClH/c24-19(7-5-16-4-6-17(25-16)18-3-1-10-26-18)21-12-14-11-15-13-20-8-2-9-23(15)22-14;/h1,3-4,6,10-11,20H,2,5,7-9,12-13H2,(H,21,24);1H |
| InChIKey | HMRKXWDULVDBRJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |