C15H27Cl2N3O2S — CID 154896957
6-[[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methyl]-1,4-oxazepan-6-ol;dihydrochloride (PubChem CID 154896957) has the molecular formula C15H27Cl2N3O2S and a molecular weight of 384.37 g/mol. Its IUPAC name is 6-[[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methyl]-1,4-oxazepan-6-ol;dihydrochloride.
| Compound Name | 6-[[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methyl]-1,4-oxazepan-6-ol;dihydrochloride |
|---|---|
| PubChem CID | 154896957 |
| Molecular Formula | C15H27Cl2N3O2S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 6-[[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethylamino]methyl]-1,4-oxazepan-6-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(CNCCc2nc3c(s2)CCCC3)CNCCOC1 |
| InChI | InChI=1S/C15H25N3O2S.2ClH/c19-15(10-17-7-8-20-11-15)9-16-6-5-14-18-12-3-1-2-4-13(12)21-14;;/h16-17,19H,1-11H2;2*1H |
| InChIKey | ITDLERDJNPHHRZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|