About 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride
6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride (PubChem CID 154897014) has the molecular formula C14H25Cl2N3O2
and a molecular weight of 338.28 g/mol. Its IUPAC name is 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride.
Molecular Properties
| Compound Name | 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride |
| PubChem CID | 154897014 |
| Molecular Formula | C14H25Cl2N3O2 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(CNCCCc2ccncc2)CNCCOC1 |
| InChI | InChI=1S/C14H23N3O2.2ClH/c18-14(11-17-8-9-19-12-14)10-16-5-1-2-13-3-6-15-7-4-13;;/h3-4,6-7,16-18H,1-2,5,8-12H2;2*1H |
| InChIKey | GTLVIIYHSJPDMM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride?
The IUPAC name of 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride (CID 154897014) is 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride.
What is the SMILES notation for 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride?
The canonical SMILES for 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride is Cl.Cl.OC1(CNCCCc2ccncc2)CNCCOC1.
What is the InChIKey of 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride?
The InChIKey is GTLVIIYHSJPDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2.2ClH/c18-14(11-17-8-9-19-12-14)10-16-5-1-2-13-3-6-15-7-4-13;;/h3-4,6-7,16-18H,1-2,5,8-12H2;2*1H.
What are the key properties of 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride?
6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride has a molecular weight of 338.28 g/mol, XLogP of 0.80, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-pyridin-4-ylpropylamino)methyl]-1,4-oxazepan-6-ol;dihydrochloride is sourced from PubChem (CID 154897014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).