About 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride
1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride (PubChem CID 154897227) has the molecular formula C18H26ClN3O2
and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride |
| PubChem CID | 154897227 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride |
| SMILES | Cl.O=C1N(CC2CCCCO2)c2ccccc2NC12CCNCC2 |
| InChI | InChI=1S/C18H25N3O2.ClH/c22-17-18(8-10-19-11-9-18)20-15-6-1-2-7-16(15)21(17)13-14-5-3-4-12-23-14;/h1-2,6-7,14,19-20H,3-5,8-13H2;1H |
| InChIKey | XTQCWPNHAUNXTQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride?
The IUPAC name of 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride (CID 154897227) is 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride.
What is the SMILES notation for 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride?
The canonical SMILES for 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride is Cl.O=C1N(CC2CCCCO2)c2ccccc2NC12CCNCC2.
What is the InChIKey of 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride?
The InChIKey is XTQCWPNHAUNXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O2.ClH/c22-17-18(8-10-19-11-9-18)20-15-6-1-2-7-16(15)21(17)13-14-5-3-4-12-23-14;/h1-2,6-7,14,19-20H,3-5,8-13H2;1H.
What are the key properties of 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride?
1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride has a molecular weight of 351.88 g/mol, XLogP of 2.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-2-ylmethyl)spiro[4H-quinoxaline-3,4'-piperidine]-2-one;hydrochloride is sourced from PubChem (CID 154897227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).