C16H26Cl2N2O — CID 154897459
(3R,4S)-1-cyclopentyl-4-(3-methoxyphenyl)pyrrolidin-3-amine;dihydrochloride (PubChem CID 154897459) has the molecular formula C16H26Cl2N2O and a molecular weight of 333.30 g/mol. Its IUPAC name is (3R,4S)-1-cyclopentyl-4-(3-methoxyphenyl)pyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3R,4S)-1-cyclopentyl-4-(3-methoxyphenyl)pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 154897459 |
| Molecular Formula | C16H26Cl2N2O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3R,4S)-1-cyclopentyl-4-(3-methoxyphenyl)pyrrolidin-3-amine;dihydrochloride |
| SMILES | COc1cccc([C@H]2CN(C3CCCC3)C[C@@H]2N)c1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O.2ClH/c1-19-14-8-4-5-12(9-14)15-10-18(11-16(15)17)13-6-2-3-7-13;;/h4-5,8-9,13,15-16H,2-3,6-7,10-11,17H2,1H3;2*1H/t15-,16+;;/m1../s1 |
| InChIKey | XILMFJFBMLDJEJ-AFMFUHLNSA-N |
| XLogP | 3.21 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |