About (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride
(3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 154898040) has the molecular formula C11H22Cl2N6
and a molecular weight of 309.25 g/mol. Its IUPAC name is (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride |
| PubChem CID | 154898040 |
| Molecular Formula | C11H22Cl2N6 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1CN(CCCn2cnnn2)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C11H20N6.2ClH/c12-11-7-16(6-10(11)9-2-3-9)4-1-5-17-8-13-14-15-17;;/h8-11H,1-7,12H2;2*1H/t10-,11+;;/m1../s1 |
| InChIKey | FXRNLNOXTYKBTK-OXPNAJOUSA-N |
| XLogP | 0.58 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride?
The IUPAC name of (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride (CID 154898040) is (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride.
What is the SMILES notation for (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride?
The canonical SMILES for (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride is Cl.Cl.N[C@H]1CN(CCCn2cnnn2)C[C@@H]1C1CC1.
What is the InChIKey of (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride?
The InChIKey is FXRNLNOXTYKBTK-OXPNAJOUSA-N. The full InChI is InChI=1S/C11H20N6.2ClH/c12-11-7-16(6-10(11)9-2-3-9)4-1-5-17-8-13-14-15-17;;/h8-11H,1-7,12H2;2*1H/t10-,11+;;/m1../s1.
What are the key properties of (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride?
(3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride has a molecular weight of 309.25 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-cyclopropyl-1-[3-(tetrazol-1-yl)propyl]pyrrolidin-3-amine;dihydrochloride is sourced from PubChem (CID 154898040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).