C21H30Cl2N4O2 — CID 154898192
5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one;dihydrochloride (PubChem CID 154898192) has the molecular formula C21H30Cl2N4O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one;dihydrochloride.
| Compound Name | 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one;dihydrochloride |
|---|---|
| PubChem CID | 154898192 |
| Molecular Formula | C21H30Cl2N4O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 5-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl]-2-(1-adamantyl)-1H-pyrimidin-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cnc(C23CC4CC(CC(C4)C2)C3)[nH]c1=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C21H28N4O2.2ClH/c26-18-16(19(27)25-2-1-15-9-22-11-17(15)25)10-23-20(24-18)21-6-12-3-13(7-21)5-14(4-12)8-21;;/h10,12-15,17,22H,1-9,11H2,(H,23,24,26);2*1H/t12?,13?,14?,15-,17+,21?;;/m0../s1 |
| InChIKey | SXEBEDUTLBOINU-RPVJGTMLSA-N |
| XLogP | 2.52 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |