About 3,4-bis(ethenyl)furan
3,4-bis(ethenyl)furan (PubChem CID 15489835) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3,4-bis(ethenyl)furan.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)furan |
| PubChem CID | 15489835 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 3,4-bis(ethenyl)furan |
| SMILES | C=Cc1cocc1C=C |
| InChI | InChI=1S/C8H8O/c1-3-7-5-9-6-8(7)4-2/h3-6H,1-2H2 |
| InChIKey | XANKKJZVYHLLIM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-bis(ethenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)furan?
The IUPAC name of 3,4-bis(ethenyl)furan (CID 15489835) is 3,4-bis(ethenyl)furan.
What is the SMILES notation for 3,4-bis(ethenyl)furan?
The canonical SMILES for 3,4-bis(ethenyl)furan is C=Cc1cocc1C=C.
What is the InChIKey of 3,4-bis(ethenyl)furan?
The InChIKey is XANKKJZVYHLLIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-3-7-5-9-6-8(7)4-2/h3-6H,1-2H2.
What are the key properties of 3,4-bis(ethenyl)furan?
3,4-bis(ethenyl)furan has a molecular weight of 120.15 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)furan is sourced from PubChem (CID 15489835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).