C17H25Cl2N3O — CID 154898940
2-(2-butoxy-5-methylphenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine;dihydrochloride (PubChem CID 154898940) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-(2-butoxy-5-methylphenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine;dihydrochloride.
| Compound Name | 2-(2-butoxy-5-methylphenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 154898940 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-(2-butoxy-5-methylphenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine;dihydrochloride |
| SMILES | CCCCOc1ccc(C)cc1-c1nc2c([nH]1)CNCC2.Cl.Cl |
| InChI | InChI=1S/C17H23N3O.2ClH/c1-3-4-9-21-16-6-5-12(2)10-13(16)17-19-14-7-8-18-11-15(14)20-17;;/h5-6,10,18H,3-4,7-9,11H2,1-2H3,(H,19,20);2*1H |
| InChIKey | RUHNFCDUZLETCK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|