C16H24ClN5O3 — CID 154899443
1-(3-methoxypropyl)-3-(pyrimidin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 154899443) has the molecular formula C16H24ClN5O3 and a molecular weight of 369.85 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(pyrimidin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 1-(3-methoxypropyl)-3-(pyrimidin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 154899443 |
| Molecular Formula | C16H24ClN5O3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(pyrimidin-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | COCCCN1C(=O)N(Cc2ncccn2)C(=O)C12CCNCC2.Cl |
| InChI | InChI=1S/C16H23N5O3.ClH/c1-24-11-3-10-21-15(23)20(12-13-18-6-2-7-19-13)14(22)16(21)4-8-17-9-5-16;/h2,6-7,17H,3-5,8-12H2,1H3;1H |
| InChIKey | DBFOLRORZQYJNC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|