C13H16ClF3N4O — CID 154900355
N-methyl-3-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]propan-1-amine;hydrochloride (PubChem CID 154900355) has the molecular formula C13H16ClF3N4O and a molecular weight of 336.75 g/mol. Its IUPAC name is N-methyl-3-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]propan-1-amine;hydrochloride.
| Compound Name | N-methyl-3-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 154900355 |
| Molecular Formula | C13H16ClF3N4O |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-methyl-3-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]propan-1-amine;hydrochloride |
| SMILES | CNCCCn1cc(-c2ccc(OC(F)(F)F)cc2)nn1.Cl |
| InChI | InChI=1S/C13H15F3N4O.ClH/c1-17-7-2-8-20-9-12(18-19-20)10-3-5-11(6-4-10)21-13(14,15)16;/h3-6,9,17H,2,7-8H2,1H3;1H |
| InChIKey | VNCUGHZELLJMKY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|