C13H17Cl3FN3O — CID 154900922
(3aS,6aS)-N-(4-chloro-2-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide;dihydrochloride (PubChem CID 154900922) has the molecular formula C13H17Cl3FN3O and a molecular weight of 356.66 g/mol. Its IUPAC name is (3aS,6aS)-N-(4-chloro-2-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide;dihydrochloride.
| Compound Name | (3aS,6aS)-N-(4-chloro-2-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 154900922 |
| Molecular Formula | C13H17Cl3FN3O |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (3aS,6aS)-N-(4-chloro-2-fluorophenyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(Cl)cc1F)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H15ClFN3O.2ClH/c14-9-1-2-11(10(15)5-9)17-13(19)18-4-3-8-6-16-7-12(8)18;;/h1-2,5,8,12,16H,3-4,6-7H2,(H,17,19);2*1H/t8-,12+;;/m0../s1 |
| InChIKey | DAWBFUHBVJAEPS-PFFLJUHOSA-N |
| XLogP | 3.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |