C16H28Cl2N4O — CID 154901907
6-(3-aminocyclobutyl)-N-methyl-N-[2-(oxan-4-yl)ethyl]pyrimidin-4-amine;dihydrochloride (PubChem CID 154901907) has the molecular formula C16H28Cl2N4O and a molecular weight of 363.33 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-methyl-N-[2-(oxan-4-yl)ethyl]pyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-methyl-N-[2-(oxan-4-yl)ethyl]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154901907 |
| Molecular Formula | C16H28Cl2N4O |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-methyl-N-[2-(oxan-4-yl)ethyl]pyrimidin-4-amine;dihydrochloride |
| SMILES | CN(CCC1CCOCC1)c1cc(C2CC(N)C2)ncn1.Cl.Cl |
| InChI | InChI=1S/C16H26N4O.2ClH/c1-20(5-2-12-3-6-21-7-4-12)16-10-15(18-11-19-16)13-8-14(17)9-13;;/h10-14H,2-9,17H2,1H3;2*1H |
| InChIKey | PZNSBGQHZZBAEW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |